1-epi-Regadenoson structure
|
Common Name | 1-epi-Regadenoson | ||
|---|---|---|---|---|
| CAS Number | 2015222-31-6 | Molecular Weight | 390.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-epi-Regadenoson1-epi-Regadenoson is an αisomer impurity of Regadenoson which is a highly selective adenosine A2A receptor agonist[1]. |
| Name | 1-epi-Regadenoson |
|---|
| Description | 1-epi-Regadenoson is an αisomer impurity of Regadenoson which is a highly selective adenosine A2A receptor agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H18N8O5 |
|---|---|
| Molecular Weight | 390.35 |
| InChIKey | LZPZPHGJDAGEJZ-UUAIRXRESA-N |
| SMILES | CNC(=O)c1cnn(-c2nc(N)c3ncn(C4OC(CO)C(O)C4O)c3n2)c1 |