2-Chloro-3,5-bis(trifluoromethyl)aniline structure
|
Common Name | 2-Chloro-3,5-bis(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 201593-90-0 | Molecular Weight | 263.568 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 202.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 76.3±27.3 °C | |
| Name | 2-Chloro-3,5-bis(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 202.5±40.0 °C at 760 mmHg |
| Molecular Formula | C8H4ClF6N |
| Molecular Weight | 263.568 |
| Flash Point | 76.3±27.3 °C |
| Exact Mass | 262.993652 |
| PSA | 26.02000 |
| LogP | 5.31 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | JKUFETFGEJPHEM-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Chloro-α,α,α,α',α',α'-hexafluoro-3,5-xylidine |
| 3,5-Bis(trifluoromethyl)-2-chloroaniline |
| 3,5-bis(trifluoromethyl)-2-chloro aniline |
| 2-Chloro-3,5-bis(trifluoromethyl)aniline |
| MFCD04038716 |
| Benzenamine, 2-chloro-3,5-bis(trifluoromethyl)- |