n,n-dimethylformamide dibenzyl acetal structure
|
Common Name | n,n-dimethylformamide dibenzyl acetal | ||
|---|---|---|---|---|
| CAS Number | 2016-04-8 | Molecular Weight | 271.35400 | |
| Density | 1.045 g/mL at 25 °C(lit.) | Boiling Point | 118-120 °C(lit.) | |
| Molecular Formula | C17H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212 °F | |
| Name | N,N-dimethyl-1,1-bis(phenylmethoxy)methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.045 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 118-120 °C(lit.) |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.35400 |
| Flash Point | 212 °F |
| Exact Mass | 271.15700 |
| PSA | 21.70000 |
| LogP | 3.26520 |
| Vapour Pressure | 3.39E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.536(lit.) |
| InChIKey | JFIKHFNGAURIIB-UHFFFAOYSA-N |
| SMILES | CN(C)C(OCc1ccccc1)OCc1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2922199090 |
|
~%
n,n-dimethylfor... CAS#:2016-04-8 |
| Literature: Helvetica Chimica Acta, , vol. 48, p. 1746 - 1771 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methanamine,N,N-dimethyl-1,1-bis(phenylmethoxy) |
| N,N-Dimethylformamide dibenzylacetal |
| DMF-dibenzyl acetal |
| MFCD00014869 |
| EINECS 217-946-7 |
| dimethyl formamide dibenzyl acetal |
| 1,1-di(benzyloxy)-N,N-dimethylmethanamine |
| 1,1-Dibenzyloxytrimethylamine |