Cell-permeable Caspase-3 Inhibitor I trifluoroacetate salt structure
|
Common Name | Cell-permeable Caspase-3 Inhibitor I trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 201608-15-3 | Molecular Weight | 2000.378 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1637.5±75.0 °C at 760 mmHg | |
| Molecular Formula | C94H158N20O27 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 944.1±37.1 °C | |
Use of Cell-permeable Caspase-3 Inhibitor I trifluoroacetate saltAc-AAVALLPAVLLALLAP-DEVD-CHO (DEVD-CHO-CPP 32) is a potent and reversible caspase-3 inhibitor[1]. |
| Name | Cell-permeable Caspase-3 Inhibitor I trifluoroacetate salt |
|---|
| Description | Ac-AAVALLPAVLLALLAP-DEVD-CHO (DEVD-CHO-CPP 32) is a potent and reversible caspase-3 inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
Caspase 3 |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1637.5±75.0 °C at 760 mmHg |
| Molecular Formula | C94H158N20O27 |
| Molecular Weight | 2000.378 |
| Flash Point | 944.1±37.1 °C |
| Exact Mass | 1999.160522 |
| LogP | 18.72 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | UUACDJMODMQION-UWOLOOPLSA-N |
| SMILES | CC(=O)NC(C)C(=O)NC(C)C(=O)NC(C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)N1CCCC1C(=O)NC(C)C(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(C=O)CC(=O)O)C(C)C)C(C)C)C(C)C.O=C(O)C(F)(F)F |