diethyl 2,2-dichloropropanedioate
diethyl 2,2-dichloropropanedioate structure
|
Common Name | diethyl 2,2-dichloropropanedioate | ||
|---|---|---|---|---|
| CAS Number | 20165-81-5 | Molecular Weight | 229.05800 | |
| Density | 1.317g/cm3 | Boiling Point | 230ºC at 760 mmHg | |
| Molecular Formula | C7H10Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2,2-dichloropropanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 230ºC at 760 mmHg |
| Molecular Formula | C7H10Cl2O4 |
| Molecular Weight | 229.05800 |
| Flash Point | 85ºC |
| Exact Mass | 227.99600 |
| PSA | 52.60000 |
| LogP | 1.28650 |
| Vapour Pressure | 0.0673mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | QVRUXRSUYSWFJN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)(Cl)C(=O)OCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917190090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
CAS#:105-53-3
CAS#:515-84-4
CAS#:14064-10-9
CAS#:421-83-0
CAS#:20165-80-4
CAS#:64-17-5
CAS#:56857-23-9
CAS#:81289-78-3
CAS#:7782-50-5
CAS#:29263-83-0
CAS#:6174-95-4
CAS#:63959-94-4![1-[2-(4-nitro-phenoxy)ethyl]-1H-imidazole structure](https://image.chemsrc.com/caspic/080/75911-83-0.png)
CAS#:75911-83-0
CAS#:683-72-7
CAS#:30989-14-1
CAS#:1087-97-4
CAS#:3092-20-4
CAS#:4459-16-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2-dichloromalonic acid diethyl ester |
| EINECS 243-550-9 |
| Cl2C(CO2Et)2 |
| diethyl 2,2-dichloromalonate |
| Diethyl dichloromalonate |
| dichloromalonic acid diethyl ester |
| Dichlor-malonsaeure-diaethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of diethyl 2,2-dichloropropanedioate? |
| A: Boiling point of diethyl 2,2-dichloropropanedioate is 230ºC at 760 mmHg. |
| Q: What are the upstream materials of diethyl 2,2-dichloropropanedioate? |
| A: Related upstream materials(CAS) of diethyl 2,2-dichloropropanedioate: 105-53-3;515-84-4;14064-10-9;421-83-0;20165-80-4;64-17-5;56857-23-9;81289-78-3;7782-50-5. |
| Q: What English synonyms does diethyl 2,2-dichloropropanedioate have? |
| A: English synonyms of diethyl 2,2-dichloropropanedioate: 2,2-dichloromalonic acid diethyl ester, EINECS 243-550-9, Cl2C(CO2Et)2, diethyl 2,2-dichloromalonate, Diethyl dichloromalonate, dichloromalonic acid diethyl ester, Dichlor-malonsaeure-diaethylester. |
| Q: What is the CAS number of diethyl 2,2-dichloropropanedioate? |
| A: CAS number of diethyl 2,2-dichloropropanedioate is 20165-81-5. |
| Q: What is the InChIKey of diethyl 2,2-dichloropropanedioate? |
| A: InChIKey of diethyl 2,2-dichloropropanedioate is QVRUXRSUYSWFJN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of diethyl 2,2-dichloropropanedioate? |
| A: Molecular formula of diethyl 2,2-dichloropropanedioate is C7H10Cl2O4. |
| Q: What is the molecular weight of diethyl 2,2-dichloropropanedioate? |
| A: Molecular weight of diethyl 2,2-dichloropropanedioate is 229.05800. |
| Q: What are the downstream products of diethyl 2,2-dichloropropanedioate? |
| A: Related downstream products(CAS) of diethyl 2,2-dichloropropanedioate: 14064-10-9;29263-83-0;6174-95-4;63959-94-4;75911-83-0;683-72-7;30989-14-1;1087-97-4;3092-20-4;4459-16-9. |
| Q: What is the polar surface area (PSA) of diethyl 2,2-dichloropropanedioate? |
| A: Polar surface area (PSA) of diethyl 2,2-dichloropropanedioate is 52.60000. |
| Q: What is the SMILES notation of diethyl 2,2-dichloropropanedioate? |
| A: SMILES notation of diethyl 2,2-dichloropropanedioate is CCOC(=O)C(Cl)(Cl)C(=O)OCC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |