H-Phe-Pro-Ala-pNA structure
|
Common Name | H-Phe-Pro-Ala-pNA | ||
|---|---|---|---|---|
| CAS Number | 201738-99-0 | Molecular Weight | 453.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H27N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Phe-Pro-Ala-pNAPhe-Pro-Ala-pNA is a chromogenic substrate of tripeptidyl peptidase. Phe-Pro-Ala-pNA can be used to test tripeptidyl peptidase activity[1]. |
| Name | (2S)-1-[(2S)-2-amino-3-phenylpropanoyl]-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Phe-Pro-Ala-pNA is a chromogenic substrate of tripeptidyl peptidase. Phe-Pro-Ala-pNA can be used to test tripeptidyl peptidase activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H27N5O5 |
|---|---|
| Molecular Weight | 453.49 |
| Exact Mass | 453.20100 |
| PSA | 153.84000 |
| LogP | 3.67370 |
| InChIKey | IQYNDHOCCCUVDQ-YSSFQJQWSA-N |
| SMILES | CC(NC(=O)C1CCCN1C(=O)C(N)Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| L-Alaninamide,L-phenylalanyl-L-prolyl-N-(4-nitrophenyl) |
| H-Phe-Pro-Ala-pNA |