Chlorazanil (hydrochloride) structure
|
Common Name | Chlorazanil (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 2019-25-2 | Molecular Weight | 258.10700 | |
| Density | 1.483g/cm3 | Boiling Point | 457.2ºC at 760mmHg | |
| Molecular Formula | C9H9Cl2N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.3ºC | |
Use of Chlorazanil (hydrochloride)Chlorazanil hydrochloride is a orally effective diuretic agent. |
| Name | 2-N-(4-chlorophenyl)-1,3,5-triazine-2,4-diamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Chlorazanil hydrochloride is a orally effective diuretic agent. |
|---|---|
| Related Catalog |
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 457.2ºC at 760mmHg |
| Molecular Formula | C9H9Cl2N5 |
| Molecular Weight | 258.10700 |
| Flash Point | 230.3ºC |
| Exact Mass | 257.02400 |
| PSA | 76.72000 |
| LogP | 3.30700 |
| InChIKey | UYCMHUVQSSDLAM-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ncnc(Nc2ccc(Cl)cc2)n1 |
| Storage condition | 2-8℃ |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Orpidan |
| 2-AMINO-4-p-CHLOROANILINO-sym-TRIAZINE HCl |
| Chlorazanil HCl |
| Chlorazanil (hydrochloride) |