phenyl 11-iodoundec-10-ynoate structure
|
Common Name | phenyl 11-iodoundec-10-ynoate | ||
|---|---|---|---|---|
| CAS Number | 2020-25-9 | Molecular Weight | 384.25200 | |
| Density | 1.383g/cm3 | Boiling Point | 439.1ºC at 760mmHg | |
| Molecular Formula | C17H21IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3ºC | |
| Name | phenyl 11-iodoundec-10-ynoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 439.1ºC at 760mmHg |
| Molecular Formula | C17H21IO2 |
| Molecular Weight | 384.25200 |
| Flash Point | 219.3ºC |
| Exact Mass | 384.05900 |
| PSA | 26.30000 |
| LogP | 5.10870 |
| Vapour Pressure | 6.58E-08mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | YXYXRFVXKCHITA-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCCC#CI)Oc1ccccc1 |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 11-Iod-10-undecin-saeurephenylester |
| UNII-VXD0H11TQ7 |
| 11-Iod-10-undecynoesaeure-phenylester |
| phenyliodoundecynoate |
| Phenyl 11-iodo-10-undecynoate |