trimethylgermanium,triphenyltin structure
|
Common Name | trimethylgermanium,triphenyltin | ||
|---|---|---|---|---|
| CAS Number | 20213-95-0 | Molecular Weight | 467.75600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24GeSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethylgermanium,triphenyltin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H24GeSn |
|---|---|
| Molecular Weight | 467.75600 |
| Exact Mass | 470.01100 |
| LogP | 5.45020 |
| InChIKey | IDDYPOMIAAUTSP-UHFFFAOYSA-N |
| SMILES | C[Ge](C)C.c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
|
~55%
trimethylgerman... CAS#:20213-95-0 |
| Literature: Pannell, Keith H.; Parkanyi, Laszlo; Sharma, Hemant; Cervantes-Lee, Francisco Inorganic Chemistry, 1992 , vol. 31, p. 522 - 524 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trimethylgermanyltriphenyltin |