H-Thr-Pro-Asn-Gln-Arg-Gln-Asn-Val-Cys-OH trifluoroacetate salt structure
|
Common Name | H-Thr-Pro-Asn-Gln-Arg-Gln-Asn-Val-Cys-OH trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 2022956-41-6 | Molecular Weight | 1059.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H70N16O15S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Thr-Pro-Asn-Gln-Arg-Gln-Asn-Val-Cys-OH trifluoroacetate saltTPNQRQNVC is a nonapeptide and is the epitope of HLA-B0702. TPNQRQNVC induces a CD8+ T cell immune response[1]. |
| Name | H-Thr-Pro-Asn-Gln-Arg-Gln-Asn-Val-Cys-OH trifluoroacetate salt |
|---|
| Description | TPNQRQNVC is a nonapeptide and is the epitope of HLA-B0702. TPNQRQNVC induces a CD8+ T cell immune response[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C41H70N16O15S |
|---|---|
| Molecular Weight | 1059.17 |
| InChIKey | TVBFEZPTPXOFET-KQZFKLDRSA-N |
| SMILES | CC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C1CCCN1C(=O)C(N)C(C)O)C(=O)NC(CS)C(=O)O.O=C(O)C(F)(F)F |