2-(2-Nitro-2-phenyl-ethenyl)furan structure
|
Common Name | 2-(2-Nitro-2-phenyl-ethenyl)furan | ||
|---|---|---|---|---|
| CAS Number | 20236-33-3 | Molecular Weight | 215.20500 | |
| Density | 1.254g/cm3 | Boiling Point | 310.4ºC at 760 mmHg | |
| Molecular Formula | C12H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.5ºC | |
| Name | 2-(2-nitro-2-phenylethenyl)furan |
|---|
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 310.4ºC at 760 mmHg |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20500 |
| Flash Point | 141.5ºC |
| Exact Mass | 215.05800 |
| PSA | 58.96000 |
| LogP | 3.57760 |
| Vapour Pressure | 0.0011mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | LFSYGMWMKSOMBT-XFXZXTDPSA-N |
| SMILES | O=[N+]([O-])C(=Cc1ccco1)c1ccccc1 |
|
~%
2-(2-Nitro-2-ph... CAS#:20236-33-3 |
| Literature: Kasiwagi Bulletin of the Chemical Society of Japan, 1927 , vol. 2, p. 112 Chem. Zentralbl., 1927 , vol. 98, # II p. 254 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |