2,2-Bis[p-(chloroformyloxy)phenyl]propane structure
|
Common Name | 2,2-Bis[p-(chloroformyloxy)phenyl]propane | ||
|---|---|---|---|---|
| CAS Number | 2024-88-6 | Molecular Weight | 353.197 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 415.2±38.0 °C at 760 mmHg | |
| Molecular Formula | C17H14Cl2O4 | Melting Point | 90-92ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 150.0±25.8 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | [4-[2-(4-carbonochloridoyloxyphenyl)propan-2-yl]phenyl] carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.2±38.0 °C at 760 mmHg |
| Melting Point | 90-92ºC(lit.) |
| Molecular Formula | C17H14Cl2O4 |
| Molecular Weight | 353.197 |
| Flash Point | 150.0±25.8 °C |
| Exact Mass | 352.026917 |
| PSA | 52.60000 |
| LogP | 5.79 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | MMWCQWOKHLEYSP-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(OC(=O)Cl)cc1)c1ccc(OC(=O)Cl)cc1 |
| Storage condition | 0-6°C |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H314-H331 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | 23/24/25-34 |
| Safety Phrases | 26-27-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2916399090 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Bisphenol A in combination with insulin can accelerate the conversion of 3T3-L1 fibroblasts to adipocytes.
J. Lipid Res. 43(5) , 676-84, (2002) The confluent cultures of 3T3-L1 fibroblasts were treated with or without bisphenol A (BPA) for 2 days and subsequently treated with insulin (INS) alone for 9 days. When BPA was absent during the firs... |
|
|
Synthesis and characterization of poly (carbonates) derived from diphenols that contain silicon or germanium. Tagle LH, et al.
J. Inorg. Organomet. Polym. Mater. 13(1) , 21-28, (2003)
|
|
|
Facile synthesis and electro-optic activities of new polycarbonates containing tricyanofuran-based nonlinear optical chromophores. Deng G, et al.
J. Polym. Sci. A Polym. Chem. 51(13) , 2841-49, (2013)
|
| 4,4'-Isopropylidenediphenol bis(chloroformate) |
| 2,2-bis-(4-chlorocarbonyloxy-phenyl)-propane |
| Propane-2,2-diyldi-4,1-phenylene dicarbonochloridate |
| BIDD:ER0407 |
| 2,2-Bis(4-chloroforMyloxyphenyl)propane |
| Propane-2,2-diyldi-4,1-phenylene dichlorocarbonate |
| 4,4'-isopropylidenediphenyl bis(chloroformate) |
| 4-(1-(4-[(Chlorocarbonyl)oxy]phenyl)-1-methylethyl)phenyl chloridocarbonate |
| Carbonochloridic acid, (1-methylethylidene)di-4,1-phenylene ester |
| MFCD00060109 |
| 2,2-Bis[p-(chloroformyloxy)phenyl]propane |
| 2,2-Propanediyldi-4,1-phenylene dicarbonochloridate |
| Carbonochloridic acid,(1-methylethylidene)di-4,1-phenylene ester |
| Bisphenol A bis(chloroformate) |
| 2,2-<p-(chloroformyloxy)phenyl>propane |
| Isopropylidenedi-p-phenylene bis(chloroformate) |
| EINECS 217-970-8 |