Glomeratose A structure
|
Common Name | Glomeratose A | ||
|---|---|---|---|---|
| CAS Number | 202471-84-9 | Molecular Weight | 562.518 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 826.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C24H34O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.9±27.8 °C | |
Use of Glomeratose AGlomeratose A is a lactate dehydrogenase inhibitor, isolated from Polygala tenuifolia[1]. |
| Name | Glomeratose A |
|---|---|
| Synonym | More Synonyms |
| Description | Glomeratose A is a lactate dehydrogenase inhibitor, isolated from Polygala tenuifolia[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: Lactate dehydrogenase[1] |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 826.5±65.0 °C at 760 mmHg |
| Molecular Formula | C24H34O15 |
| Molecular Weight | 562.518 |
| Flash Point | 274.9±27.8 °C |
| Exact Mass | 562.189758 |
| LogP | -1.33 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | PQHNJDATPYXLIX-JKCNAQEDSA-N |
| SMILES | COc1cc(C=CC(=O)OC2C(O)C(CO)OC2(CO)OC2OC(CO)C(O)C(O)C2O)cc(OC)c1OC |
| 3-O-[(2E)-3-(3,4,5-Trimethoxyphenyl)-2-propenoyl]-β-D-fructofuranosyl α-D-glucopyranoside |
| α-D-Glucopyranoside, 3-O-[(2E)-1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propen-1-yl]-β-D-fructofuranosyl |