Chloramphenicol D5 structure
|
Common Name | Chloramphenicol D5 | ||
|---|---|---|---|---|
| CAS Number | 202480-68-0 | Molecular Weight | 328.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7D5Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Chloramphenicol D5Chloramphenicol D5 is the deuterium labeled Chloramphenicol. Chloramphenicol is a broad-spectrum antibiotic against bacterial infections. |
| Name | Chloramphenicol D5 (ring D4, benzyl D) |
|---|
| Description | Chloramphenicol D5 is the deuterium labeled Chloramphenicol. Chloramphenicol is a broad-spectrum antibiotic against bacterial infections. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H7D5Cl2N2O5 |
|---|---|
| Molecular Weight | 328.16000 |
| Exact Mass | 327.04400 |
| PSA | 115.38000 |
| LogP | 1.82310 |
| InChIKey | WIIZWVCIJKGZOK-GINPRNRXSA-N |
| SMILES | O=C(NC(CO)C(O)c1ccc([N+](=O)[O-])cc1)C(Cl)Cl |