Sulfo DBCO-Maleimide
Modify Date: 2025-08-27 06:07:58
Sulfo DBCO-Maleimide structure
|
Common Name | Sulfo DBCO-Maleimide | ||
|---|---|---|---|---|
| CAS Number | 2028281-86-7 | Molecular Weight | 578.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H26N4O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo DBCO-MaleimideMal-Sulfo-DBCO is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Mal-Sulfo-DBCO |
|---|
| Description | Mal-Sulfo-DBCO is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C28H26N4O8S |
|---|---|
| Molecular Weight | 578.59 |
| InChIKey | IQQMMWCHYXQNOT-UHFFFAOYSA-N |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCC(C(=O)NCCC(=O)N1Cc2ccccc2C#Cc2ccccc21)S(=O)(=O)O |