DBCO-Maleimide structure
|
Common Name | DBCO-Maleimide | ||
|---|---|---|---|---|
| CAS Number | 1395786-30-7 | Molecular Weight | 427.452 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 790.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C25H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 431.9±32.9 °C | |
Use of DBCO-MaleimideDBCO-Maleimide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | N-[3-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-3-oxopropyl]-3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Description | DBCO-Maleimide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
[1]. Modified antibody and radioactive metal-labelled antibody. WO2019203191A1. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 790.5±60.0 °C at 760 mmHg |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.452 |
| Flash Point | 431.9±32.9 °C |
| Exact Mass | 427.153198 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | NHFQNAGPXIVKND-UHFFFAOYSA-N |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| Storage condition | -20°C |
| 1H-Pyrrole-1-propanamide, N-[3-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-3-oxopropyl]-2,5-dihydro-2,5-dioxo- |
| N-[3-(11,12-Didehydrodibenzo[b,f]azocin-5(6H)-yl)-3-oxopropyl]-3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamide |