fenquizone structure
|
Common Name | fenquizone | ||
|---|---|---|---|---|
| CAS Number | 20287-37-0 | Molecular Weight | 337.78100 | |
| Density | 1.469g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of fenquizoneFenquizone (MG-13054), a thiazide-like diuretic, exhibits chronic antihypertensive effect. Fenquizone can be used for the research of oedema and hypertension[1]. |
| Name | 7-chloro-4-oxo-2-phenyl-2,3-dihydro-1H-quinazoline-6-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Fenquizone (MG-13054), a thiazide-like diuretic, exhibits chronic antihypertensive effect. Fenquizone can be used for the research of oedema and hypertension[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.469g/cm3 |
|---|---|
| Molecular Formula | C14H12ClN3O3S |
| Molecular Weight | 337.78100 |
| Exact Mass | 337.02900 |
| PSA | 109.67000 |
| LogP | 4.08940 |
| Index of Refraction | 1.644 |
| InChIKey | DBDTUXMDTSTPQZ-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC(c1ccccc1)NC2=O |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Fenquizonum |
| 7-Chlor-2-phenyl-6-sulfonylamino-1,2-dihydro-3H-chinazolin-4-on |
| Fenquizone |
| fenchizone[dcit] |
| Fenquizona |
| Fenchizone |
| 7-chloro-4-oxo-2-phenyl-1,2,3,4-tetrahydro-quinazoline-6-sulfonic acid amide |
| 7-Chlor-2-phenyl-6-sulfamoyl-1,2,3,4-tetrahydro-chinazolin-4-on |
| Idrolone |