Recoflavone structure
|
Common Name | Recoflavone | ||
|---|---|---|---|---|
| CAS Number | 203191-10-0 | Molecular Weight | 386.352 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 617.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.2±25.0 °C | |
Use of RecoflavoneRecoflavone is a synthetic derivative of eupatilin that has a protective effect on gastric mucosa. Recoflavone has the potential to be used to treat peptic ulcer disease. |
| Name | 2-[2-(3,4-dimethoxyphenyl)-5-methoxy-4-oxochromen-7-yl]oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Recoflavone is a synthetic derivative of eupatilin that has a protective effect on gastric mucosa. Recoflavone has the potential to be used to treat peptic ulcer disease. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 617.7±55.0 °C at 760 mmHg |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.352 |
| Flash Point | 221.2±25.0 °C |
| Exact Mass | 386.100159 |
| PSA | 104.43000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | BCPQOBQIVJZOFL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)cc(OCC(=O)O)cc3o2)cc1OC |
|
~99%
Recoflavone CAS#:203191-10-0 |
| Literature: Dong-A Pharmaceutical Co., Ltd. Patent: WO2005/23244 A1, 2005 ; Location in patent: Page/Page column 32-33 ; |
|
~97%
Recoflavone CAS#:203191-10-0 |
| Literature: Dong-A Pharmaceutical Co., Ltd. Patent: WO2005/23244 A1, 2005 ; Location in patent: Page/Page column 29 ; |
|
~%
Recoflavone CAS#:203191-10-0 |
| Literature: Dong a Pharmaceutical Co., Ltd. Patent: US6025387 A1, 2000 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| UNII-U96J5LG435 |
| Recoflavone |
| {[2-(3,4-Dimethoxyphenyl)-5-methoxy-4-oxo-4H-chromen-7-yl]oxy}acetic acid |
| 7-Carboxymethoxyloxy-3',4',5-trimethoxyflavone |
| DA-6034 |
| Acetic acid, 2-[[2-(3,4-dimethoxyphenyl)-5-methoxy-4-oxo-4H-1-benzopyran-7-yl]oxy]- |