Benzoic acid,2-[(4-methyl-1-piperazinyl)carbonyl]- structure
|
Common Name | Benzoic acid,2-[(4-methyl-1-piperazinyl)carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 20320-46-1 | Molecular Weight | 248.27800 | |
| Density | 1.253g/cm3 | Boiling Point | 443.3ºC at 760mmHg | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.9ºC | |
| Name | 2-(4-methylpiperazine-1-carbonyl)benzoic acid |
|---|
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 443.3ºC at 760mmHg |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.27800 |
| Flash Point | 221.9ºC |
| Exact Mass | 248.11600 |
| PSA | 60.85000 |
| LogP | 0.64820 |
| Vapour Pressure | 1.22E-08mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | ZAFOSGZICIJIGO-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=O)c2ccccc2C(=O)O)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |