2-(4-Methyl-piperazin-1-yl)-benzoicacid structure
|
Common Name | 2-(4-Methyl-piperazin-1-yl)-benzoicacid | ||
|---|---|---|---|---|
| CAS Number | 159589-70-5 | Molecular Weight | 220.26800 | |
| Density | 1.188g/cm3 | Boiling Point | 372ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | 67ºC | |
| MSDS | N/A | Flash Point | 178.8ºC | |
| Name | 2-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 372ºC at 760 mmHg |
| Melting Point | 67ºC |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Flash Point | 178.8ºC |
| Exact Mass | 220.12100 |
| PSA | 43.78000 |
| LogP | 1.13950 |
| Vapour Pressure | 3.42E-06mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | WKGFDTBUUBBWJZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ccccc2C(=O)O)CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933599090 |
|
~89%
2-(4-Methyl-pip... CAS#:159589-70-5 |
| Literature: UNIVERSITE DU MAINE; CENTRE NATIONAL DE LA RECHERCHE SCIENTIFIQUE Patent: US2012/316337 A1, 2012 ; Location in patent: Page/Page column 12-13 ; |
|
~70%
2-(4-Methyl-pip... CAS#:159589-70-5 |
| Literature: UNIVERSITE DU MAINE; CENTRE NATIONAL DE LA RECHERCHE SCIENTIFIQUE Patent: US2012/316337 A1, 2012 ; Location in patent: Page/Page column 12-13 ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-methylpiperazinyl)benzoic acid |
| 2-(4-methyl-1-piperazinyl)benzoic acid |
| 2-(2H-BENZOTRIAZOL-2-YL)-4,6-DI-TERT-PENTYLPHENOL |