[3-(Trifluoromethoxy)phenyl]acetic acid structure
|
Common Name | [3-(Trifluoromethoxy)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 203302-97-0 | Molecular Weight | 220.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 260.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O3 | Melting Point | 53-55°C | |
| MSDS | N/A | Flash Point | 111.2±25.9 °C | |
| Name | 2-[3-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 260.2±35.0 °C at 760 mmHg |
| Melting Point | 53-55°C |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.145 |
| Flash Point | 111.2±25.9 °C |
| Exact Mass | 220.034729 |
| PSA | 46.53000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | NFZQVADYFXRRPM-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc(OC(F)(F)F)c1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzeneacetic acid, 3-(trifluoromethoxy)- |
| [3-(Trifluoromethoxy)phenyl]acetic acid |
| QV1R COXFFF |
| 3-(Trifluoromethoxy)phenylacetic Acid |
| 2-[3-(Trifluoromethoxy)phenyl]acetic acid |
| MFCD00082480 |
| 3-Trifluoromethoxyphenylacetic acid |
| 3-(Trifluoromethoxy)benzeneacetic acid |