methyl perfluorotetradecanoate structure
|
Common Name | methyl perfluorotetradecanoate | ||
|---|---|---|---|---|
| CAS Number | 203302-99-2 | Molecular Weight | 728.14000 | |
| Density | 1.703g/cm3 | Boiling Point | 176°C 60mm | |
| Molecular Formula | C15H3F27O2 | Melting Point | 95-98°C | |
| MSDS | N/A | Flash Point | 106ºC | |
| Name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosafluorotetradecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.703g/cm3 |
|---|---|
| Boiling Point | 176°C 60mm |
| Melting Point | 95-98°C |
| Molecular Formula | C15H3F27O2 |
| Molecular Weight | 728.14000 |
| Flash Point | 106ºC |
| Exact Mass | 727.97000 |
| PSA | 26.30000 |
| LogP | 8.34530 |
| Vapour Pressure | 0.0149mmHg at 25°C |
| Index of Refraction | 1.289 |
| InChIKey | DRRCLKOIEBNFIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| PC5142 |
| Methyl Perfluorotetradecanoate |
| MFCD00236620 |