2,6-Dichloro-9-isopropyl-9H-purine structure
|
Common Name | 2,6-Dichloro-9-isopropyl-9H-purine | ||
|---|---|---|---|---|
| CAS Number | 203436-45-7 | Molecular Weight | 231.082 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 290.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H8Cl2N4 | Melting Point | 150-151ºC | |
| MSDS | N/A | Flash Point | 129.5±30.1 °C | |
| Name | 2,6-dichloro-9-propan-2-ylpurine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.6±50.0 °C at 760 mmHg |
| Melting Point | 150-151ºC |
| Molecular Formula | C8H8Cl2N4 |
| Molecular Weight | 231.082 |
| Flash Point | 129.5±30.1 °C |
| Exact Mass | 230.012604 |
| PSA | 43.60000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | GKEFDRUWUYSFGW-UHFFFAOYSA-N |
| SMILES | CC(C)n1cnc2c(Cl)nc(Cl)nc21 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9H-Purine,2,6-dichloro-9-(1-methylethyl) |
| 2,6-DICHLORO-9-ISOPROPYLPURINE |
| 2.6-Dichloro-9-(2-propyl)purine |
| 9H-Purine, 2,6-dichloro-9-(1-methylethyl)- |
| 2,6-Dichloro-9-isopropyl-9H-purine |
| 9-iso-propyl-2,6-dichloro-9H-purine |
| 2,5-DIBROMOPYRIDINE-3-BORONIC ACID |