1-N-Cbz-4-Methylpiperidine-4-carboxylic acid structure
|
Common Name | 1-N-Cbz-4-Methylpiperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 203522-12-7 | Molecular Weight | 277.31600 | |
| Density | 1.224 | Boiling Point | 440.3ºC at 760 mmHg | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 4-methyl-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224 |
|---|---|
| Boiling Point | 440.3ºC at 760 mmHg |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31600 |
| Flash Point | 220.1ºC |
| Exact Mass | 277.13100 |
| PSA | 66.84000 |
| LogP | 2.44780 |
| Vapour Pressure | 1.57E-08mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | JNCYTJCFOLFFMZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)O)CCN(C(=O)OCc2ccccc2)CC1 |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2933399090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[(benzyloxy)carbonyl]-4-methylpiperidine-4-carboxylic acid |
| 4-methyl-piperidine-1,4-dicarboxylic acid monobenzyl ester |
| 1-N-CBZ-4-METHYLPIPERIDINE-4-CARBOXYLIC ACID |