3-(Cyanoacetyl)indole structure
|
Common Name | 3-(Cyanoacetyl)indole | ||
|---|---|---|---|---|
| CAS Number | 20356-45-0 | Molecular Weight | 184.19400 | |
| Density | 1.285 g/cm3 | Boiling Point | 447.2ºC at 760 mmHg | |
| Molecular Formula | C11H8N2O | Melting Point | 241ºC | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | 3-(1H-Indol-3-yl)-3-oxopropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285 g/cm3 |
|---|---|
| Boiling Point | 447.2ºC at 760 mmHg |
| Melting Point | 241ºC |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.19400 |
| Flash Point | 224.3ºC |
| Exact Mass | 184.06400 |
| PSA | 56.65000 |
| LogP | 2.26428 |
| Vapour Pressure | 3.43E-08mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | KSKBLDDGNWKWKN-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)c1c[nH]c2ccccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(1H-indol-3-yl)-3-oxopropanenitrile |