l-tyrosine, o-(4-hydroxyphenyl)-3,5-diiodo-, methyl ester structure
|
Common Name | l-tyrosine, o-(4-hydroxyphenyl)-3,5-diiodo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 203585-45-9 | Molecular Weight | 539.10400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15I2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | l-tyrosine, o-(4-hydroxyphenyl)-3,5-diiodo-, methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15I2NO4 |
|---|---|
| Molecular Weight | 539.10400 |
| Exact Mass | 538.90900 |
| PSA | 81.78000 |
| LogP | 4.13680 |
| InChIKey | ZNUQUHHTCGWFOR-AWEZNQCLSA-N |
| SMILES | COC(=O)C(N)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 |
|
~%
l-tyrosine, o-(... CAS#:203585-45-9 |
| Literature: Taurog et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 3473,3476 |
|
~%
l-tyrosine, o-(... CAS#:203585-45-9 |
| Literature: Dibra S.p.A. Patent: US6337064 B1, 2002 ; Location in patent: Page column 33 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O-(4-HYDROXYPHENYL)-3,5-DIIODO-L-TYROSINE METHYL ESTER |
| 3,5-diiodo-L-thyronine methyl ester |
| 3,5-Dijod-L-thyronin-methylester |