3,5-Diiodo-L-thyronine structure
|
Common Name | 3,5-Diiodo-L-thyronine | ||
|---|---|---|---|---|
| CAS Number | 1041-01-6 | Molecular Weight | 525.077 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 559.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H13I2NO4 | Melting Point | 255-260 °C (dec.) | |
| MSDS | Chinese USA | Flash Point | 292.1±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 3,5-Diiodo-L-thyronine3,5-Diiodo-L-thyronine, Iodinated thyronine hormone. regulating gene activity affecting processes such as homeostasis, lipid metabolism and insulin resistance. |
| Name | 3,5-Diiodo-L-thyronine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.4±50.0 °C at 760 mmHg |
| Melting Point | 255-260 °C (dec.) |
| Molecular Formula | C15H13I2NO4 |
| Molecular Weight | 525.077 |
| Flash Point | 292.1±30.1 °C |
| Exact Mass | 524.893372 |
| PSA | 92.78000 |
| LogP | 3.78 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | ZHSOTLOTTDYIIK-ZDUSSCGKSA-N |
| SMILES | NC(Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1)C(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922509090 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Administration of 3,5-diiodothyronine (3,5-T2) causes central hypothyroidism and stimulates thyroid-sensitive tissues.
J. Endocrinol. 221(3) , 415-27, (2014) In general, 3,5-diiodothyronine (3,5-T2) increases the resting metabolic rate and oxygen consumption, exerting short-term beneficial metabolic effects on rats subjected to a high-fat diet. Our aim was... |
|
|
In Vitro, Ex Vivo, and In Vivo Determination of Thyroid Hormone Modulating Activity of Benzothiazoles.
Toxicol. Sci. 146 , 254-64, (2015) As in vitro assays are increasingly used to screen chemicals for their potential to produce endocrine disrupting adverse effects, it is important to understand their predictive capacity. The potential... |
|
|
Ion pair hollow fiber liquid-liquid-liquid microextraction combined with capillary electrophoresis-ultraviolet detection for the determination of thyroid hormones in human serum.
J. Chromatogr. A. 1356 , 23-31, (2014) In this study, a novel, inexpensive, sensitive and selective analytical method that combines ion pair hollow fiber liquid-liquid-liquid microextraction (IP-HF-LLLME) with capillary electrophoresis-ult... |
| O-(4-Hydroxyphenyl)-3,5-diiodotyrosine |
| 3,5-Diiodo-L-thyronine |
| Tyrosine, O-(4-hydroxyphenyl)-3,5-diiodo- |
| L-O-(4-hydroxyphenyl)-3,5-diiodo-Tyrosine |
| L-tyrosine, O-(4-hydroxyphenyl)-3,5-diiodo- |
| 3,5-Diiodo-4-(4-hydroxyphenoxy)-L-phenylalanine |
| EINECS 213-867-7 |
| L-(+)-3,5-Diiodothyronine |
| (2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid |
| O-(4-Hydroxyphenyl)-3,5-diiodo-L-tyrosine |
| 3,5-T2 O-(4-Hydroxyphenyl)-3,5-diiodo-L-tyrosine |
| 3,5-di-iodo-L-thyronine |
| L-Tyrosine, O- (4-hydroxyphenyl)-3,5-diiodo- |
| Alanine, 3-[4- (p-hydroxyphenoxy)-3,5-diiodophenyl]-, L- |
| MFCD00064987 |