N-(3,5-DICHLORO-2-HYDROXY-4-METHYLPHENYL)-2-(2,4-DI-TERT-PENTYLPHENOXY)-ACETAMIDE structure
|
Common Name | N-(3,5-DICHLORO-2-HYDROXY-4-METHYLPHENYL)-2-(2,4-DI-TERT-PENTYLPHENOXY)-ACETAMIDE | ||
|---|---|---|---|---|
| CAS Number | 20364-09-4 | Molecular Weight | 466.44000 | |
| Density | 1.178g/cm3 | Boiling Point | 567.2ºC at 760 mmHg | |
| Molecular Formula | C25H33Cl2NO3 | Melting Point | 160-162ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 296.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(3,5-dichloro-2-hydroxy-4-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 567.2ºC at 760 mmHg |
| Melting Point | 160-162ºC(lit.) |
| Molecular Formula | C25H33Cl2NO3 |
| Molecular Weight | 466.44000 |
| Flash Point | 296.8ºC |
| Exact Mass | 465.18400 |
| PSA | 58.56000 |
| LogP | 7.47310 |
| Vapour Pressure | 1.81E-13mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | RGIVHZWXUHEZIP-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Nc2cc(Cl)c(C)c(Cl)c2O)c(C(C)(C)CC)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S37/S39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00128813 |
| 2-[2,4-bis(1,1-dimethylpropyl)phenoxy]-N-(3,5-dichloro-2-hydroxy-4-methylpheny l)acetamide |
| (2,4-Di-tert-pentyl-phenoxy)-essigsaeure-(3,5-dichlor-2-hydroxy-4-methyl-anilid) |
| EINECS 243-765-8 |
| N-(3,5-Dichloro-2-hydroxy-4-methylphenyl)-2-(2,4-di-tert-pentylphenoxy)acetamide |
| (2,4-di-tert-pentyl-phenoxy)-acetic acid-(3,5-dichloro-2-hydroxy-4-methyl-anilide) |