(4R)-BOC)-4-BENZYL-PYR-OBZL structure
|
Common Name | (4R)-BOC)-4-BENZYL-PYR-OBZL | ||
|---|---|---|---|---|
| CAS Number | 203645-44-7 | Molecular Weight | 409.47500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27NO5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-benzyl-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H27NO5 |
|---|---|
| Molecular Weight | 409.47500 |
| Exact Mass | 409.18900 |
| PSA | 72.91000 |
| LogP | 4.06260 |
| Vapour Pressure | 1.83E-12mmHg at 25°C |
| InChIKey | LMILJTUPJYRGKN-UXHICEINSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(Cc2ccccc2)CC1C(=O)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
|
Highly potent and selective peptide-based inhibitors of the hepatitis C virus serine protease: towards smaller inhibitors.
Bioorg. Med. Chem. Lett. 10 , 2267, (2000) Structure-activity studies on a hexapeptide N-terminal cleavage product of a dodecamer substrate led to the identification of very potent and highly specific inhibitors of the HCV NS3 protease/NS4A co... |
| (4R)-Boc-4-benzyl-L-pyroglutamic acid benzyl ester |
| (4R)-Boc-4-benzyl-Pyr-OBzl |
| Benzyl (2S,4R)-1-Boc-4-benzyl-5-oxo-2-pyrrolidinecarboxylate |