N,N-diisopropylbenzamide structure
|
Common Name | N,N-diisopropylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 20383-28-2 | Molecular Weight | 205.29600 | |
| Density | 0.97g/cm3 | Boiling Point | 148-152°C 18mm | |
| Molecular Formula | C13H19NO | Melting Point | 69-71 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 148-152°C/18mm | |
| Name | N,N-di(propan-2-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 148-152°C 18mm |
| Melting Point | 69-71 °C(lit.) |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.29600 |
| Flash Point | 148-152°C/18mm |
| Exact Mass | 205.14700 |
| PSA | 20.31000 |
| LogP | 2.94560 |
| Vapour Pressure | 0.000662mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | UYXMMJPYFKRKKM-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)c1ccccc1)C(C)C |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Alkali-metal-mediated manganationII of functionalized arenes and applications of ortho-manganated products in Pd-catalyzed cross-coupling reactions with iodobenzene.
Chemistry 14(1) , 65-72, (2008) Extending the recently introduced concept of "alkali-metal-mediated manganation" to functionalised arenes, the heteroleptic sodium manganate reagent [(tmeda)Na(tmp)(R)Mn(tmp)] (1; TMEDA=N,N,N',N'-tetr... |
|
|
Naphthalene-catalysed lithiation of N,N-diisopropylbenzamide and its methoxy derivatives. Alonso E, et al.
Tetrahedron 54(44) , 13629-38, (1998)
|
|
|
2-azaisobenzofurans as intermediates in a convenient annelation of aromatic tertiary amides. Beak P and Chen C-W.
Tetrahedron Lett. 24(29) , 2945-2948, (1983)
|
| MFCD00026370 |
| N,N-diisopropylbenzylamide |
| N,N-Diisopropylbenzamide |