Fmoc-l-beta-homoserine(otbu) structure
|
Common Name | Fmoc-l-beta-homoserine(otbu) | ||
|---|---|---|---|---|
| CAS Number | 203854-51-7 | Molecular Weight | 397.464 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 599.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.2±30.1 °C | |
| Name | FMOC-L-β-HOMOSERINE(OTBU) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 599.3±50.0 °C at 760 mmHg |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.464 |
| Flash Point | 316.2±30.1 °C |
| Exact Mass | 397.188934 |
| PSA | 84.86000 |
| LogP | 4.95 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | SKYFRYZPXHNPOK-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OCC(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~71%
Fmoc-l-beta-hom... CAS#:203854-51-7 |
| Literature: Vasanthakumar; Babu, V. V. Suresh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 7 p. 1691 - 1695 |
|
~%
Fmoc-l-beta-hom... CAS#:203854-51-7 |
| Literature: Helvetica Chimica Acta, , vol. 81, # 2 p. 187 - 206 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| FMOC-SER(OTBU)-(C*CH2)OH |
| Butanoic acid, 4-(1,1-dimethylethoxy)-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (3R)- |
| fmoc-b-homo-ser(tbu)-oh |
| Fmoc-b-HoSer(tBu)-OH |
| (3R)-4-tert-Butoxy-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid |
| O-tert-Butyl-N-Fmoc-L-beta-homoserine |
| MFCD01862865 |
| (3R)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]butanoic acid |
| FMOC-L--HOMOSERINE(OTBU) |
| Fmoc-L-β-Homo-Ser(OtBu)-OH |
| FMOC-O-TERT-BUTYL-L-Β-HOMOSERINE |
| FMOC-Β-HOSER(TBU)-OH |
| Fmoc-β-Homo-Ser(tBu)-OH |