FMOC-L-BETA-HOMOTHREONINE(OTBU) structure
|
Common Name | FMOC-L-BETA-HOMOTHREONINE(OTBU) | ||
|---|---|---|---|---|
| CAS Number | 353245-99-5 | Molecular Weight | 411.491 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 602.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H29NO5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 318.1±31.5 °C | |
| Name | (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.3±55.0 °C at 760 mmHg |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.491 |
| Flash Point | 318.1±31.5 °C |
| Exact Mass | 411.204559 |
| PSA | 84.86000 |
| LogP | 5.30 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | UFJMOCVIPRJMLW-QVKFZJNVSA-N |
| SMILES | CC(OC(C)(C)C)C(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
~72%
FMOC-L-BETA-HOM... CAS#:353245-99-5 |
| Literature: Gademann; Kimmerlin; Hoyer; Seebach Journal of Medicinal Chemistry, 2001 , vol. 44, # 15 p. 2460 - 2468 |
|
~%
FMOC-L-BETA-HOM... CAS#:353245-99-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 44, # 15 p. 2460 - 2468 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (3R,4R)-4-tert-Butoxy-3-(Fmoc-amino)pentanoic acid |
| Fmoc-|A-HoThr(tBu)-OH |
| (3R,4R)-4-(tert-butoxy)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}pentanoic acid |
| D-threo-Pentonic acid, 2,3,5-trideoxy-4-O-(1,1-dimethylethyl)-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- |
| 2,3,5-Trideoxy-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-O-(2-methyl-2-propanyl)-D-threo-pentonic acid |
| (R)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-(R)-(tert-butoxy)pentanoic acid |