4-Quinolinecarboxylicacid, 2-(2-chlorophenyl)- structure
|
Common Name | 4-Quinolinecarboxylicacid, 2-(2-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 20389-09-7 | Molecular Weight | 283.70900 | |
| Density | 1.373g/cm3 | Boiling Point | 464.6ºC at 760mmHg | |
| Molecular Formula | C16H10ClNO2 | Melting Point | 264-266ºC | |
| MSDS | N/A | Flash Point | 234.8ºC | |
| Name | 2-(2-chlorophenyl)quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 464.6ºC at 760mmHg |
| Melting Point | 264-266ºC |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.70900 |
| Flash Point | 234.8ºC |
| Exact Mass | 283.04000 |
| PSA | 50.19000 |
| LogP | 4.25340 |
| Vapour Pressure | 1.97E-09mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | QBRGQUCIJZKQAY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
|
~%
4-Quinolinecarb... CAS#:20389-09-7 |
| Literature: US5627193 A1, ; US 5627193 A |
|
~%
4-Quinolinecarb... CAS#:20389-09-7 |
| Literature: DE375715 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 522 |
|
~%
4-Quinolinecarb... CAS#:20389-09-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 40, # 12 p. 1794 - 1807 |
|
~%
4-Quinolinecarb... CAS#:20389-09-7 |
| Literature: DE375715 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 522 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-Chloro-phenyl)-quinoline-4-carboxylic acid |
| 2-(2-AMINOETHYLAMINO)ADENOSINE-3',5'-CYCLIC MONOPHOSPHOROTHIOATE |
| 2-(2-Chlorphenyl)-chinolin-4-carbonsaeure |
| MFCD00783457 |
| 2-(2-chlorophenyl)-4-quinolinecarboxylic acid |