sodium trimethylsilylpropylsulfonate structure
|
Common Name | sodium trimethylsilylpropylsulfonate | ||
|---|---|---|---|---|
| CAS Number | 2039-96-5 | Molecular Weight | 218.322 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H15NaO3SSi | Melting Point | ~165 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Name | sodium,3-trimethylsilylpropane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | ~165 °C (dec.)(lit.) |
|---|---|
| Molecular Formula | C6H15NaO3SSi |
| Molecular Weight | 218.322 |
| Exact Mass | 218.040878 |
| PSA | 65.58000 |
| LogP | 2.34070 |
| Index of Refraction | 1.45 |
| InChIKey | HWEXKRHYVOGVDA-UHFFFAOYSA-M |
| SMILES | C[Si](C)(C)CCCS(=O)(=O)[O-].[Na+] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
1H-NMR-based profiling of organic components in leachate from animal carcasses disposal site with time.
Environ. Sci. Pollut. Res. Int. 21(17) , 10453-60, (2014) Leachate, generated by the decomposition of animal carcasses, presents many environmental, sanitary, and food safety hazards. However, research on the characteristics of leachate is lacking. In this s... |
|
|
Structural elucidation of an asparagine-linked oligosaccharide from the hyperthermophilic archaeon, Archaeoglobus fulgidus.
Carbohydr. Res. 413 , 55-62, (2015) The genome of the hyperthermophilic archaeon, Archaeoglobus fulgidus, contains three paralogous AglB genes that encode oligosaccharyltransferase (OST) proteins. The OST enzymes catalyze the transfer o... |
|
|
Shuttle DNP spectrometer with a two-center magnet.
Phys. Chem. Chem. Phys. 12(22) , 5830-40, (2010) A DNP set-up is described where a liquid sample is hyperpolarized by the electron-nucleus Overhauser effect in a field of 0.34 T and transferred to a field of 14.09 T for NMR detection. In contrast to... |
| 3-(Trimethylsilyl)-1-propane sulfonic acid sodium salt |
| 2,2-Dimethyl-2-silapentane-5-sulfonate sodium salt |
| sodium 2,2-dimethyl-2-silapentane-5-sulfonate |
| SodiuM 3-(TriMethylsilyl)-1-propanesulfonate [1H NMR |
| sodium 3-(trimethylsilyl)-propane-1-sulfonate |
| Sodium 3-sulfopropyltrimethylsilane |
| sodium 3-(trimethylsilyl)propanesulfonate |
| sodium 2,2-dimethyl-2-silapentane-5-sulphonate |
| MFCD00007537 |
| 1-Propanesulfonic acid, 3-(trimethylsilyl)-, sodium salt (1:1) |
| 3-(Trimethylsilyl)-1-propanesulfonic acid |
| sodium 4,4-dimethyl-4-silapentane-1-sulfonate |
| 1-Propanesulfonic acid, 3- (trimethylsilyl)-, sodium salt |
| DSS sodium salt |
| 3-(Trimethylsilyl)propanesulfonic acid |
| 2,2-dimethyl-2-silapentane-5-sulphonic acid sodium salt |
| EINECS 218-031-5 |
| Sodium 3-(trimethylsilyl)propane sulfonate |
| sodium 3-(trimethylsilyl)propylsulfonate |
| 1-Propanesulfonic acid, 3-(trimethylsilyl)-, sodium salt |
| 3-(trimethylsilyl)-1-propanesulfonic acid,sodium salt |
| sodium trimethylsilylpropylsulfonate |
| sodium 3-(trimethylsilyl)propane-1-sulfonate |
| sodium 3-(trimethylsilyl)propyl-sulfonate |
| Sodium 3-(trimethylsilyl)-1-propanesulfonate |