1,3,4-Oxadiazole,2,5-bis([1,1'-biphenyl]-4-yl)- structure
|
Common Name | 1,3,4-Oxadiazole,2,5-bis([1,1'-biphenyl]-4-yl)- | ||
|---|---|---|---|---|
| CAS Number | 2043-06-3 | Molecular Weight | 374.43400 | |
| Density | 1.17g/cm3 | Boiling Point | 568.8ºC at 760mmHg | |
| Molecular Formula | C26H18N2O | Melting Point | 235-238ºC | |
| MSDS | N/A | Flash Point | 290.8ºC | |
| Name | 2,5-bis(4-phenylphenyl)-1,3,4-oxadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 568.8ºC at 760mmHg |
| Melting Point | 235-238ºC |
| Molecular Formula | C26H18N2O |
| Molecular Weight | 374.43400 |
| Flash Point | 290.8ºC |
| Exact Mass | 374.14200 |
| PSA | 38.92000 |
| LogP | 6.73760 |
| Vapour Pressure | 2.29E-12mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | IVVYVRLKDGGUEL-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc(-c3nnc(-c4ccc(-c5ccccc5)cc4)o3)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| HS Code | 2934999090 |
|
~%
1,3,4-Oxadiazol... CAS#:2043-06-3 |
| Literature: Hayes et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 1850 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 218-046-7 |
| 2,5-dibiphenylyl-1,3,4-oxadiazole |
| MFCD00042666 |
| 2,5-Bis(4-biphenylyl)-1,3,4-oxadiazole |