2-(chloromethyl)-1-methyl-5-nitro-benzoimidazole structure
|
Common Name | 2-(chloromethyl)-1-methyl-5-nitro-benzoimidazole | ||
|---|---|---|---|---|
| CAS Number | 20443-39-4 | Molecular Weight | 225.63200 | |
| Density | 1.5g/cm3 | Boiling Point | 416.3ºC at 760 mmHg | |
| Molecular Formula | C9H8ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6ºC | |
| Name | 2-(chloromethyl)-1-methyl-5-nitrobenzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 416.3ºC at 760 mmHg |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.63200 |
| Flash Point | 205.6ºC |
| Exact Mass | 225.03100 |
| PSA | 63.64000 |
| LogP | 2.74350 |
| Vapour Pressure | 9.34E-07mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | CHNOXQSJGAMOSS-UHFFFAOYSA-N |
| SMILES | Cn1c(CCl)nc2cc([N+](=O)[O-])ccc21 |
| HS Code | 2933990090 |
|---|
|
~68%
2-(chloromethyl... CAS#:20443-39-4 |
| Literature: Bai, Yu-Bin; Zhang, An-Ling; Tang, Jiang-Jiang; Gao, Jin-Ming Journal of Agricultural and Food Chemistry, 2013 , vol. 61, # 11 p. 2789 - 2795 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloromethyl-1-methyl-5-nitro-1H-benzimidazole |
| 2-chloromethyl-1-methyl-5-nitro-1H-benzoimidazole |
| 1-Methyl-2-chloromethyl-5-nitrobenzimidazole |
| 2-(3-FORMYL-2,5-DIMETHYL-PYRROL-1-YL)-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBONITRILE |
| N1-Methyl-2-chlormethyl-5-nitro-benzimidazol |
| chloromethylmethylnitrobenzodiazole |
| 2-(chloromethyl)-1-methyl-5-nitro-1H-1,3-benzodiazole |