3,5-Dinitro-2-thiophenamine structure
|
Common Name | 3,5-Dinitro-2-thiophenamine | ||
|---|---|---|---|---|
| CAS Number | 2045-70-7 | Molecular Weight | 189.149 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 422.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C4H3N3O4S | Melting Point | 174-176 °C(lit.) | |
| MSDS | USA | Flash Point | 209.0±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,5-dinitrothiophen-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.0±40.0 °C at 760 mmHg |
| Melting Point | 174-176 °C(lit.) |
| Molecular Formula | C4H3N3O4S |
| Molecular Weight | 189.149 |
| Flash Point | 209.0±27.3 °C |
| Exact Mass | 188.984421 |
| PSA | 145.90000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | DZRZHFOFVWAKGT-UHFFFAOYSA-N |
| SMILES | Nc1sc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
The synthesis of highly active thiophene ring-containing chromophore components for photonic polymers based on a newly designed route. Yuquan S, et al.
J. Chem. Soc. Perkin Trans. I 24 , 3691-3695, (1999)
|
|
|
Synthesis and characterization of hetarylazo disperse dyes derived from substituted N-ß-acetoxyethylanilines-Application on cellulose acetate. Georgiadou KL, et al.
J. Appl. Polym. Sci. 92(6) , 3479-3483, (2004)
|
| 2-Thiophenamine, 3,5-dinitro- |
| 3,5-dinitro-2-amino thiophene |
| Thiophene, 2-amino-3,5-dinitro- |
| 2,5-dinitrothiophen-2-amine |
| MFCD00100126 |
| BIDD:GT0433 |
| 2-Amino-3,5-dinitrothiophene |
| 3,5-dinitro-thiophen-2-ylamine |
| 3,5-dinitro-2-thienylamine |
| 3,5-Dinitro-2-thiophenamine |
| 2-Amino-3,5-dinitrothiophen |
| 3,5-dinitrothiophen-2-amine |
| EINECS 218-065-0 |