3,3,11,11-Tetraethyl-7-[2-(triethylsiloxy)ethyl]-4,10-dioxa-7-aza-3,11-disilatridecane structure
|
Common Name | 3,3,11,11-Tetraethyl-7-[2-(triethylsiloxy)ethyl]-4,10-dioxa-7-aza-3,11-disilatridecane | ||
|---|---|---|---|---|
| CAS Number | 20467-10-1 | Molecular Weight | 491.97100 | |
| Density | 0.881g/cm3 | Boiling Point | 444ºC at 760 mmHg | |
| Molecular Formula | C24H57NO3Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | 2-triethylsilyloxy-N,N-bis(2-triethylsilyloxyethyl)ethanamine |
|---|
| Density | 0.881g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760 mmHg |
| Molecular Formula | C24H57NO3Si3 |
| Molecular Weight | 491.97100 |
| Flash Point | 222.3ºC |
| Exact Mass | 491.36500 |
| PSA | 30.93000 |
| LogP | 7.35380 |
| Vapour Pressure | 4.42E-08mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | CXKUNERLOFUGPZ-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)OCCN(CCO[Si](CC)(CC)CC)CCO[Si](CC)(CC)CC |
| HS Code | 2931900090 |
|---|
|
~%
3,3,11,11-Tetra... CAS#:20467-10-1 |
| Literature: Lukevits,E. et al. J. Gen. Chem. USSR (Engl. Transl.), 1968 , vol. 38, p. 400 - 402,397 - 398 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |