3-hydroxy-2,3,7-trimethoxy-2-phenyl-chroman-4-one structure
|
Common Name | 3-hydroxy-2,3,7-trimethoxy-2-phenyl-chroman-4-one | ||
|---|---|---|---|---|
| CAS Number | 2047-54-3 | Molecular Weight | 330.33200 | |
| Density | 1.32g/cm3 | Boiling Point | 509.5ºC at 760 mmHg | |
| Molecular Formula | C18H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | 3-hydroxy-2,3,7-trimethoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 509.5ºC at 760 mmHg |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.33200 |
| Flash Point | 185ºC |
| Exact Mass | 330.11000 |
| PSA | 74.22000 |
| LogP | 2.10470 |
| Vapour Pressure | 3.31E-11mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | JVTAXJOSRYRUQM-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)OC(OC)(c1ccccc1)C(O)(OC)C2=O |
| HS Code | 2932999099 |
|---|
|
~90%
3-hydroxy-2,3,7... CAS#:2047-54-3 |
| Literature: Kumar; Singh Synthetic Communications, 1992 , vol. 22, # 9 p. 1333 - 1337 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,7-Dimethoxy-3,4-flavandion-methyl-3-halbketal |
| 3-hydroxy-2,3,7-trimethoxy-2-phenyl-chroman-4-one |
| 2,7-Dimethoxy-3,4-flavandion-<methyl-3-hemiacetal> |
| 3-Hydroxy-2,3,7-trimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |