diethyl 2,5-dimethyl-1H-pyrrole-3,4-dicarboxylate structure
|
Common Name | diethyl 2,5-dimethyl-1H-pyrrole-3,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2199-56-6 | Molecular Weight | 239.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2,5-dimethyl-1H-pyrrole-3,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17NO4 |
|---|---|
| Molecular Weight | 239.26800 |
| Exact Mass | 239.11600 |
| PSA | 68.39000 |
| LogP | 1.98490 |
| InChIKey | AGTHLNPLTSEZRB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1C(=O)OCC |
| HS Code | 2933990090 |
|---|
|
~98%
diethyl 2,5-dim... CAS#:2199-56-6 |
| Literature: Zhang, Chun; Wang, Jian; Li, Jing-Hua Journal of Heterocyclic Chemistry, 2012 , vol. 49, # 1 p. 204 - 207 |
|
~%
diethyl 2,5-dim... CAS#:2199-56-6 |
| Literature: Sugimoto Yakugaku Zasshi, 1944 , vol. 64, # 3 p. 192,195 Chem.Abstr., 1951 , p. 2862 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Dimethyl-3,4-diethoxycarbonyl-pyrrol |
| 1H-Pyrrole-3,4-dicarboxylic acid,2,5-dimethyl-,diethyl ester |
| Diethyl-2,5-dimethylpyrrol-3,4-dicarboxylat |
| 2,5-dimethyl-1H-pyrrole-3,4-dicarboxylic acid diethyl ester |
| 2,5-Dimethyl-pyrrol-3,4-dicarbonsaeure-diaethylester |
| 2,5-dimethyl-pyrrole-3,4-dicarboxylic acid diethyl ester |
| diethyl 2,5-dimethylpyrrole-3,4-dicarboxylate |