Osimertinib analogue
Modify Date: 2025-08-25 18:35:30
Osimertinib analogue structure
|
Common Name | Osimertinib analogue | ||
|---|---|---|---|---|
| CAS Number | 2050521-74-7 | Molecular Weight | 500.607 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32N8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Osimertinib analogueOsimertinib analogue (C-005) is a potent EGFR inhibitor, which is 2-5 fold more selective than Osimertinib between above EGFR mutants and wild-type EGFR(A431) cells. |
| Name | Osimertinib analogue |
|---|
| Description | Osimertinib analogue (C-005) is a potent EGFR inhibitor, which is 2-5 fold more selective than Osimertinib between above EGFR mutants and wild-type EGFR(A431) cells. |
|---|
| Molecular Formula | C27H32N8O2 |
|---|---|
| Molecular Weight | 500.607 |
| InChIKey | SLWGAMHEUFJZOW-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4cccnc34)n2)c(OC)cc1N(C)CCN(C)C |