Benzamide,4-fluoro-N-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | Benzamide,4-fluoro-N-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 2054-00-4 | Molecular Weight | 283.22100 | |
| Density | 1.374g/cm3 | Boiling Point | 265.8ºC at 760 mmHg | |
| Molecular Formula | C14H9F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6ºC | |
| Name | 4-fluoro-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 265.8ºC at 760 mmHg |
| Molecular Formula | C14H9F4NO |
| Molecular Weight | 283.22100 |
| Flash Point | 114.6ºC |
| Exact Mass | 283.06200 |
| PSA | 29.10000 |
| LogP | 4.16980 |
| Vapour Pressure | 0.00896mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | KQBKWPYXZQEBCF-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
|
~95%
Benzamide,4-flu... CAS#:2054-00-4 |
| Literature: Vigorita; Saporito; Previtera; et al. Farmaco, Edizione Scientifica, 1986 , vol. 41, # 2 p. 168 - 174 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms1394a01 |