Taxezopidine G structure
|
Common Name | Taxezopidine G | ||
|---|---|---|---|---|
| CAS Number | 205440-22-8 | Molecular Weight | 608.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H44O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Taxezopidine GTaxezopidine G is a natural product, that can be isolated from the seeds and stems of Japanese Yew Taxus cuspidata[1]. |
| Name | 9α,10β,13α-triacetoxy-5α-(cinnamoyloxy)taxa-4(20),11-dien-2α-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Taxezopidine G is a natural product, that can be isolated from the seeds and stems of Japanese Yew Taxus cuspidata[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C35H44O9 |
|---|---|
| Molecular Weight | 608.72 |
| Exact Mass | 608.29900 |
| PSA | 125.43000 |
| LogP | 5.11630 |
| InChIKey | NQINDQGQJLIYFL-PBRGCZQGSA-N |
| SMILES | C=C1C(OC(=O)C=Cc2ccccc2)CCC2(C)C(OC(C)=O)C(OC(C)=O)C3=C(C)C(OC(C)=O)CC(C(O)C12)C3(C)C |
| Hazard Codes | Xi |
|---|
| taxinine NN-1 |
| taxezopidine G |
| (E)-3-Phenyl-acrylic acid (1R,2R,3R,5S,8R,9R,10R,13S)-9,10,13-triacetoxy-2-hydroxy-8,12,15,15-tetramethyl-4-methylene-tricyclo[9.3.1.03,8]pentadec-11-en-5-yl ester |
| taxezopidin G |