boc-d-3,4,5-trifluorophenylalanine structure
|
Common Name | boc-d-3,4,5-trifluorophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 205445-55-2 | Molecular Weight | 319.27600 | |
| Density | 1.323g/cm3 | Boiling Point | 424.4ºC at 760mmHg | |
| Molecular Formula | C14H16F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.5ºC | |
| Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 424.4ºC at 760mmHg |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.27600 |
| Flash Point | 210.5ºC |
| Exact Mass | 319.10300 |
| PSA | 75.63000 |
| LogP | 3.01520 |
| Vapour Pressure | 5.83E-08mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | CWPLICWOIFEQMR-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(F)c(F)c(F)c1)C(=O)O |
| Storage condition | Keep Cold |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2S)-2-[(tert-Butoxycarbonyl)amino]-3-(3,4,5-trifluorophenyl)propanoic acid |
| PC0309 |
| MFCD00797559 |