PC-Biotin-PEG4-NHS carbonate
Modify Date: 2025-08-27 10:11:42
PC-Biotin-PEG4-NHS carbonate structure
|
Common Name | PC-Biotin-PEG4-NHS carbonate | ||
|---|---|---|---|---|
| CAS Number | 2055198-03-1 | Molecular Weight | 810.87 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H50N6O14S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PC-Biotin-PEG4-NHS carbonatePC-Biotin-PEG4-NHS carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | PC-Biotin-PEG4-NHS carbonate |
|---|
| Description | PC-Biotin-PEG4-NHS carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C35H50N6O14S |
|---|---|
| Molecular Weight | 810.87 |
| InChIKey | APFWBUQXFFFWPE-WMEVZKCTSA-N |
| SMILES | CC(OC(=O)ON1C(=O)CCC1=O)c1cc(CNC(=O)CCOCCOCCOCCOCCNC(=O)CCCCC2SCC3NC(=O)NC32)ccc1[N+](=O)[O-] |