Claficapavir structure
|
Common Name | Claficapavir | ||
|---|---|---|---|---|
| CAS Number | 2055732-24-4 | Molecular Weight | 393.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12ClNO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ClaficapavirClaficapavir (A1752) is a specific nucleocapsid protein (NC) inhibitor with an IC50 around 1 μM. Claficapavir strongly binds the HIV-1 NC (Kd=20 nM) thereby inhibiting the chaperone properties of NC and leading to good antiviral activity against the HIV-1[1]. |
| Name | Claficapavir |
|---|
| Description | Claficapavir (A1752) is a specific nucleocapsid protein (NC) inhibitor with an IC50 around 1 μM. Claficapavir strongly binds the HIV-1 NC (Kd=20 nM) thereby inhibiting the chaperone properties of NC and leading to good antiviral activity against the HIV-1[1]. |
|---|---|
| Related Catalog | |
| Target |
HIV-1 |
| In Vitro | Claficapavir binds directly to HIV-1 NC, thereby inhibiting specific chaperone functions of NC including Psi RNA dimerization and complementary trans-activation response element (cTAR) DNA destabilization, and it also disrupts the proper Gag processing[1]. |
| References |
| Molecular Formula | C17H12ClNO4S2 |
|---|---|
| Molecular Weight | 393.86 |
| InChIKey | YZLFZFALAZYTCI-ZROIWOOFSA-N |
| SMILES | O=C(O)CCN1C(=O)C(=Cc2ccc(-c3ccc(Cl)cc3)o2)SC1=S |
| Hazard Codes | Xi |
|---|