N-(4-methoxyphenyl)diazenyl-N-phenyl-acetamide structure
|
Common Name | N-(4-methoxyphenyl)diazenyl-N-phenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 20567-31-1 | Molecular Weight | 269.29900 | |
| Density | 1.12g/cm3 | Boiling Point | 397.6ºC at 760 mmHg | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | Butyl-4-n-methoxybenzyliden-4'-aminobenzoat |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 397.6ºC at 760 mmHg |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.29900 |
| Flash Point | 194.3ºC |
| Exact Mass | 269.11600 |
| PSA | 54.26000 |
| LogP | 3.74700 |
| Vapour Pressure | 1.57E-06mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | YYTQRGQUMLSPAX-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=NN(C(C)=O)c2ccccc2)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |