Urea, N- (4-methoxyphenyl)-N-phenyl- structure
|
Common Name | Urea, N- (4-methoxyphenyl)-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 3746-53-0 | Molecular Weight | 242.27300 | |
| Density | 1.249g/cm3 | Boiling Point | 303.8ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.5ºC | |
| Name | 1-(4-methoxyphenyl)-3-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 303.8ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Flash Point | 137.5ºC |
| Exact Mass | 242.10600 |
| PSA | 50.36000 |
| LogP | 3.48520 |
| Index of Refraction | 1.662 |
| InChIKey | NTRVJFMCRHBODE-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)Nc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-p-anisoyl-3-phenylurea |
| Carbanilide,4-methoxy |