Propanal, 2-methyl-,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Propanal, 2-methyl-,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 2057-82-1 | Molecular Weight | 252.22700 | |
| Density | 1.37 g/cm3 | Boiling Point | 394.8ºC at 760 mmHg | |
| Molecular Formula | C10H12N4O4 | Melting Point | 185 °C | |
| MSDS | USA | Flash Point | 192.5ºC | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | isobutyraldehyde 2,4-dinitrophenylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37 g/cm3 |
|---|---|
| Boiling Point | 394.8ºC at 760 mmHg |
| Melting Point | 185 °C |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.22700 |
| Flash Point | 192.5ºC |
| Exact Mass | 252.08600 |
| PSA | 116.03000 |
| LogP | 3.67610 |
| Vapour Pressure | 1.93E-06mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | WYSDOKPZMGYVGI-IZZDOVSWSA-N |
| SMILES | CC(C)C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Storage condition | 0-6°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H319 |
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
| Hazard Codes | F: Flammable;Xn: Harmful; |
| Risk Phrases | R11 |
| Safety Phrases | 16-26-36/37 |
| RIDADR | UN 1648 3 |
| Hazard Class | 1.0 |
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| isobutyraldehyde-2,4-dnph solution |
| isobutyral 2,4-dinitrophenylhydrazone |
| N-(2-methylpropylideneamino)-2,4-dinitroaniline |
| ISOBUTYRALDEHYDE (DNPH DERIVATIVE) |
| isobutyraldehyde-(2,4-dinitro-phenylhydrazone) |
| Isobutyraldehyde 2,4-Dinitrophenylhydrazone |
| 1-(2-methylpropylidene)-2-(2,4-dinitrophenyl)hydrazine |
| ISOBUTYRALDEHYDE-DNPH,1X1ML,ACN 100UG/ ML |
| (1E)-2-Methylpropanal (2,4-dinitrophenyl)hydrazone |
| Isobutyraldehydedinitrophenylhydrazone |
| Isobutyraldehyde dnp |
| ISOBUTYRALDEHYDE-DNPH |
| 2-methylpropanal (2,4-dinitrophenyl)hydrazone |
| 2-methylpropionaldehyde 2,4-dinitrophenylhydrazone |