3-Pentanol,2-methyl-2-nitro- structure
|
Common Name | 3-Pentanol,2-methyl-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 20570-67-6 | Molecular Weight | 147.17200 | |
| Density | 1.064g/cm3 | Boiling Point | 225.7ºC at 760mmHg | |
| Molecular Formula | C6H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.9ºC | |
| Name | 2-methyl-2-nitropentan-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 225.7ºC at 760mmHg |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17200 |
| Flash Point | 95.9ºC |
| Exact Mass | 147.09000 |
| PSA | 66.05000 |
| LogP | 1.33580 |
| Vapour Pressure | 0.0169mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | XGIVOZBEDLLCCO-UHFFFAOYSA-N |
| SMILES | CCC(O)C(C)(C)[N+](=O)[O-] |
|
~85%
3-Pentanol,2-me... CAS#:20570-67-6 |
| Literature: Crich, David; Ranganathan, Krishnakumar; Rumthao, Sochanchingwung; Shirai, Michio Journal of Organic Chemistry, 2003 , vol. 68, # 5 p. 2034 - 2037 |
|
~%
Detail
|
| Literature: Degering; Hoaglin Proceedings of the Indiana Academy of Science, 1942 , vol. 52, p. 119 Chem.Abstr., 1944 , p. 1470 |
| 2-Nitro-2-methyl-3-hydroxy-pentan |
| 4-Nitro-4-methyl-3-pentanol |
| 3-Pentanol,2-methyl-2-nitro |
| 2-methyl-2-nitro-pentan-3-ol |